C21H19ClN6O2 — CID 135228290
3-(1,3-benzoxazol-2-yl)-8-chloro-5-(2-methoxyethanimidoyl)-8,9-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepin-6-imine (PubChem CID 135228290) has the molecular formula C21H19ClN6O2 and a molecular weight of 422.88 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-8-chloro-5-(2-methoxyethanimidoyl)-8,9-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepin-6-imine.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-8-chloro-5-(2-methoxyethanimidoyl)-8,9-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepin-6-imine |
|---|---|
| PubChem CID | 135228290 |
| Molecular Formula | C21H19ClN6O2 |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-8-chloro-5-(2-methoxyethanimidoyl)-8,9-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepin-6-imine |
| SMILES | [H]/N=C(\COC)N1Cc2c(-c3nc4ccccc4o3)ncn2C2=CCC(Cl)C=C2/C1=N\[H] |
| InChI | InChI=1S/C21H19ClN6O2/c1-29-10-18(23)27-9-16-19(21-26-14-4-2-3-5-17(14)30-21)25-11-28(16)15-7-6-12(22)8-13(15)20(27)24/h2-5,7-8,11-12,23-24H,6,9-10H2,1H3/b23-18+,24-20+ |
| InChIKey | XWZFZRMNZLRXBG-LWUFTARWSA-N |
| XLogP | 3.89 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|