C17H28N2 — CID 135228527
2,3,5-tritert-butyl-1,4-diazacyclohepta-2,4,6,7-tetraene (PubChem CID 135228527) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 2,3,5-tritert-butyl-1,4-diazacyclohepta-2,4,6,7-tetraene.
| Compound Name | 2,3,5-tritert-butyl-1,4-diazacyclohepta-2,4,6,7-tetraene |
|---|---|
| PubChem CID | 135228527 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 2,3,5-tritert-butyl-1,4-diazacyclohepta-2,4,6,7-tetraene |
| SMILES | CC(C)(C)C1=NC(C(C)(C)C)=C(C(C)(C)C)N=C=C1 |
| InChI | InChI=1S/C17H28N2/c1-15(2,3)12-10-11-18-13(16(4,5)6)14(19-12)17(7,8)9/h10H,1-9H3 |
| InChIKey | LLCOWPIUOUHQBF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |