C22H32FN — CID 135228890
N-[(E)-2-[6-(4-cyclohexylpent-4-en-2-yl)-5-fluorocyclohexa-2,4-dien-1-yl]prop-1-enyl]ethanimine (PubChem CID 135228890) has the molecular formula C22H32FN and a molecular weight of 329.50 g/mol. Its IUPAC name is N-[(E)-2-[6-(4-cyclohexylpent-4-en-2-yl)-5-fluorocyclohexa-2,4-dien-1-yl]prop-1-enyl]ethanimine.
| Compound Name | N-[(E)-2-[6-(4-cyclohexylpent-4-en-2-yl)-5-fluorocyclohexa-2,4-dien-1-yl]prop-1-enyl]ethanimine |
|---|---|
| PubChem CID | 135228890 |
| Molecular Formula | C22H32FN |
| Molecular Weight | 329.50 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | N-[(E)-2-[6-(4-cyclohexylpent-4-en-2-yl)-5-fluorocyclohexa-2,4-dien-1-yl]prop-1-enyl]ethanimine |
| SMILES | C=C(CC(C)C1C(F)=CC=CC1/C(C)=C/N=C/C)C1CCCCC1 |
| InChI | InChI=1S/C22H32FN/c1-5-24-15-18(4)20-12-9-13-21(23)22(20)17(3)14-16(2)19-10-7-6-8-11-19/h5,9,12-13,15,17,19-20,22H,2,6-8,10-11,14H2,1,3-4H3/b18-15+,24-5+ |
| InChIKey | AQKWZJNEUFTPFC-KRAWKCRHSA-N |
| XLogP | 6.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|