C31H39N3O — CID 135228913
(1E,3E)-4-(6-tert-butyl-10-methoxy-2-methylidene-3-prop-1-en-2-yl-6,7-dihydrobenzo[a]quinolizin-9-yl)-1-N'-prop-1-en-2-ylhexa-1,3,5-triene-1,1-diamine (PubChem CID 135228913) has the molecular formula C31H39N3O and a molecular weight of 469.67 g/mol. Its IUPAC name is (1E,3E)-4-(6-tert-butyl-10-methoxy-2-methylidene-3-prop-1-en-2-yl-6,7-dihydrobenzo[a]quinolizin-9-yl)-1-N'-prop-1-en-2-ylhexa-1,3,5-triene-1,1-diamine.
| Compound Name | (1E,3E)-4-(6-tert-butyl-10-methoxy-2-methylidene-3-prop-1-en-2-yl-6,7-dihydrobenzo[a]quinolizin-9-yl)-1-N'-prop-1-en-2-ylhexa-1,3,5-triene-1,1-diamine |
|---|---|
| PubChem CID | 135228913 |
| Molecular Formula | C31H39N3O |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | (1E,3E)-4-(6-tert-butyl-10-methoxy-2-methylidene-3-prop-1-en-2-yl-6,7-dihydrobenzo[a]quinolizin-9-yl)-1-N'-prop-1-en-2-ylhexa-1,3,5-triene-1,1-diamine |
| SMILES | C=C/C(=C\C=C(/N)NC(=C)C)c1cc2c(cc1OC)C1=CC(=C)C(C(=C)C)=CN1C(C(C)(C)C)C2 |
| InChI | InChI=1S/C31H39N3O/c1-11-22(12-13-30(32)33-20(4)5)25-15-23-16-29(31(7,8)9)34-18-26(19(2)3)21(6)14-27(34)24(23)17-28(25)35-10/h11-15,17-18,29,33H,1-2,4,6,16,32H2,3,5,7-10H3/b22-12+,30-13+ |
| InChIKey | RIXXOEVDIWCTGM-NMTMADOYSA-N |
| XLogP | 6.83 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|