C27H42FN — CID 135228966
N-[(E)-[7-(4-butyl-4-methylcyclohexyl)-4-fluoro-5-methyl-5,6,7,8,9,10a-hexahydro-4aH-benzo[8]annulen-10-ylidene]methyl]ethanimine (PubChem CID 135228966) has the molecular formula C27H42FN and a molecular weight of 399.64 g/mol. Its IUPAC name is N-[(E)-[7-(4-butyl-4-methylcyclohexyl)-4-fluoro-5-methyl-5,6,7,8,9,10a-hexahydro-4aH-benzo[8]annulen-10-ylidene]methyl]ethanimine.
| Compound Name | N-[(E)-[7-(4-butyl-4-methylcyclohexyl)-4-fluoro-5-methyl-5,6,7,8,9,10a-hexahydro-4aH-benzo[8]annulen-10-ylidene]methyl]ethanimine |
|---|---|
| PubChem CID | 135228966 |
| Molecular Formula | C27H42FN |
| Molecular Weight | 399.64 g/mol |
| Exact Mass | 399.33 |
| IUPAC Name | N-[(E)-[7-(4-butyl-4-methylcyclohexyl)-4-fluoro-5-methyl-5,6,7,8,9,10a-hexahydro-4aH-benzo[8]annulen-10-ylidene]methyl]ethanimine |
| SMILES | C/C=N/C=C1\CCC(C2CCC(C)(CCCC)CC2)CC(C)C2C(F)=CC=CC12 |
| InChI | InChI=1S/C27H42FN/c1-5-7-15-27(4)16-13-21(14-17-27)22-11-12-23(19-29-6-2)24-9-8-10-25(28)26(24)20(3)18-22/h6,8-10,19-22,24,26H,5,7,11-18H2,1-4H3/b23-19+,29-6+ |
| InChIKey | GEGNJDDIAVQMPL-IBKDOIOESA-N |
| XLogP | 8.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.64 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|