C10H16FNO — CID 135229493
(3S,5Z,7E)-3-amino-7-fluoro-4-methylidenenona-5,7-dien-1-ol (PubChem CID 135229493) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is (3S,5Z,7E)-3-amino-7-fluoro-4-methylidenenona-5,7-dien-1-ol.
| Compound Name | (3S,5Z,7E)-3-amino-7-fluoro-4-methylidenenona-5,7-dien-1-ol |
|---|---|
| PubChem CID | 135229493 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (3S,5Z,7E)-3-amino-7-fluoro-4-methylidenenona-5,7-dien-1-ol |
| SMILES | C=C(/C=C\C(F)=C/C)[C@@H](N)CCO |
| InChI | InChI=1S/C10H16FNO/c1-3-9(11)5-4-8(2)10(12)6-7-13/h3-5,10,13H,2,6-7,12H2,1H3/b5-4-,9-3+/t10-/m0/s1 |
| InChIKey | BWVWFBOGEORIKZ-MKQYVOAYSA-N |
| XLogP | 1.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|