C28H35F2N3O — CID 135229987
2-[[(2E)-2-[(3Z,4E,5Z)-3,4-di(ethylidene)-7-pyrrolidin-1-ylocta-5,7-dien-2-ylidene]-3-methylidenepiperazin-1-yl]methyl]-3,6-difluorophenol (PubChem CID 135229987) has the molecular formula C28H35F2N3O and a molecular weight of 467.60 g/mol. Its IUPAC name is 2-[[(2E)-2-[(3Z,4E,5Z)-3,4-di(ethylidene)-7-pyrrolidin-1-ylocta-5,7-dien-2-ylidene]-3-methylidenepiperazin-1-yl]methyl]-3,6-difluorophenol.
| Compound Name | 2-[[(2E)-2-[(3Z,4E,5Z)-3,4-di(ethylidene)-7-pyrrolidin-1-ylocta-5,7-dien-2-ylidene]-3-methylidenepiperazin-1-yl]methyl]-3,6-difluorophenol |
|---|---|
| PubChem CID | 135229987 |
| Molecular Formula | C28H35F2N3O |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 2-[[(2E)-2-[(3Z,4E,5Z)-3,4-di(ethylidene)-7-pyrrolidin-1-ylocta-5,7-dien-2-ylidene]-3-methylidenepiperazin-1-yl]methyl]-3,6-difluorophenol |
| SMILES | C=C1NCCN(Cc2c(F)ccc(F)c2O)/C1=C(C)/C(=C\C)C(/C=C\C(=C)N1CCCC1)=C/C |
| InChI | InChI=1S/C28H35F2N3O/c1-6-22(11-10-19(3)32-15-8-9-16-32)23(7-2)20(4)27-21(5)31-14-17-33(27)18-24-25(29)12-13-26(30)28(24)34/h6-7,10-13,31,34H,3,5,8-9,14-18H2,1-2,4H3/b11-10-,22-6+,23-7+,27-20+ |
| InChIKey | UTULVAMLKQICQM-OQLXAFKCSA-N |
| XLogP | 5.92 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|