C26H28F3N3O2 — CID 135230893
1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]azetidine-3-carboxylic acid (PubChem CID 135230893) has the molecular formula C26H28F3N3O2 and a molecular weight of 471.52 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 135230893 |
| Molecular Formula | C26H28F3N3O2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]azetidine-3-carboxylic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(N3CC(C(=O)O)C3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C26H28F3N3O2/c1-14-8-18-17-6-4-5-7-21(17)30-23(18)24(32(14)13-26(2,3)29)22-19(27)9-16(10-20(22)28)31-11-15(12-31)25(33)34/h4-7,9-10,14-15,24,30H,8,11-13H2,1-3H3,(H,33,34)/t14-,24-/m1/s1 |
| InChIKey | URPWLJYBWKTVPC-JBEBIEQOSA-N |
| XLogP | 5.05 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|