About 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine
1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine (PubChem CID 135230919) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine.
Molecular Properties
| Compound Name | 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine |
| PubChem CID | 135230919 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine |
| SMILES | C=C/C(=N\C)C1=CCCC=N1 |
| InChI | InChI=1S/C9H12N2/c1-3-8(10-2)9-6-4-5-7-11-9/h3,6-7H,1,4-5H2,2H3/b10-8+ |
| InChIKey | LVYKBZQOQQPYNI-CSKARUKUSA-N |
| XLogP | 1.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine?
The IUPAC name of 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine (CID 135230919) is 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine.
What is the SMILES notation for 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine?
The canonical SMILES for 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine is C=C/C(=N\C)C1=CCCC=N1.
What is the InChIKey of 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine?
The InChIKey is LVYKBZQOQQPYNI-CSKARUKUSA-N. The full InChI is InChI=1S/C9H12N2/c1-3-8(10-2)9-6-4-5-7-11-9/h3,6-7H,1,4-5H2,2H3/b10-8+.
What are the key properties of 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine?
1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine has a molecular weight of 148.21 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydropyridin-6-yl)-N-methylprop-2-en-1-imine is sourced from PubChem (CID 135230919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).