About [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate
[3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate (PubChem CID 135231424) has the molecular formula C17H29N3O8
and a molecular weight of 403.43 g/mol. Its IUPAC name is [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate.
Molecular Properties
| Compound Name | [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate |
| PubChem CID | 135231424 |
| Molecular Formula | C17H29N3O8 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate |
| SMILES | NCCC(=O)OCC1(COC(=O)CCN)COC(=O)CCNCCC(=O)OC1 |
| InChI | InChI=1S/C17H29N3O8/c18-5-1-13(21)25-9-17(10-26-14(22)2-6-19)11-27-15(23)3-7-20-8-4-16(24)28-12-17/h20H,1-12,18-19H2 |
| InChIKey | XNVZRRJSKPWWEG-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 169.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate?
The IUPAC name of [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate (CID 135231424) is [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate.
What is the SMILES notation for [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate?
The canonical SMILES for [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate is NCCC(=O)OCC1(COC(=O)CCN)COC(=O)CCNCCC(=O)OC1.
What is the InChIKey of [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate?
The InChIKey is XNVZRRJSKPWWEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O8/c18-5-1-13(21)25-9-17(10-26-14(22)2-6-19)11-27-15(23)3-7-20-8-4-16(24)28-12-17/h20H,1-12,18-19H2.
What are the key properties of [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate?
[3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate has a molecular weight of 403.43 g/mol, XLogP of -1.77, 8 rotatable bonds, 3 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-aminopropanoyloxymethyl)-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl]methyl 3-aminopropanoate is sourced from PubChem (CID 135231424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).