About (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate
(3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate (PubChem CID 135231616) has the molecular formula C16H28N2O6
and a molecular weight of 344.41 g/mol. Its IUPAC name is (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate.
Molecular Properties
| Compound Name | (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate |
| PubChem CID | 135231616 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate |
| SMILES | CCC1(COC(=O)CCN)COC(=O)CCN(C)CCC(=O)OC1 |
| InChI | InChI=1S/C16H28N2O6/c1-3-16(10-22-13(19)4-7-17)11-23-14(20)5-8-18(2)9-6-15(21)24-12-16/h3-12,17H2,1-2H3 |
| InChIKey | BQBZWBUOSNRGAG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate?
The IUPAC name of (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate (CID 135231616) is (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate.
What is the SMILES notation for (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate?
The canonical SMILES for (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate is CCC1(COC(=O)CCN)COC(=O)CCN(C)CCC(=O)OC1.
What is the InChIKey of (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate?
The InChIKey is BQBZWBUOSNRGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O6/c1-3-16(10-22-13(19)4-7-17)11-23-14(20)5-8-18(2)9-6-15(21)24-12-16/h3-12,17H2,1-2H3.
What are the key properties of (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate?
(3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate has a molecular weight of 344.41 g/mol, XLogP of 0.09, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-9-methyl-6,12-dioxo-1,5-dioxa-9-azacyclododec-3-yl)methyl 3-aminopropanoate is sourced from PubChem (CID 135231616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).