C22H21F3N6O2S — CID 135231676
N-[3-[[5-methyl-3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]-1,2,4-triazol-1-yl]methyl]phenyl]sulfanylpropan-1-amine (PubChem CID 135231676) has the molecular formula C22H21F3N6O2S and a molecular weight of 490.51 g/mol. Its IUPAC name is N-[3-[[5-methyl-3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]-1,2,4-triazol-1-yl]methyl]phenyl]sulfanylpropan-1-amine.
| Compound Name | N-[3-[[5-methyl-3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]-1,2,4-triazol-1-yl]methyl]phenyl]sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 135231676 |
| Molecular Formula | C22H21F3N6O2S |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-[3-[[5-methyl-3-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]-1,2,4-triazol-1-yl]methyl]phenyl]sulfanylpropan-1-amine |
| SMILES | CCCNSc1cccc(Cn2nc(-c3nc(-c4ccc(OC(F)(F)F)cc4)no3)nc2C)c1 |
| InChI | InChI=1S/C22H21F3N6O2S/c1-3-11-26-34-18-6-4-5-15(12-18)13-31-14(2)27-20(29-31)21-28-19(30-33-21)16-7-9-17(10-8-16)32-22(23,24)25/h4-10,12,26H,3,11,13H2,1-2H3 |
| InChIKey | CHRQAQOHZKGHMH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|