C23H25ClN2O2S2 — CID 135231691
(3R)-3-[(3E)-3-chloro-4-(3-methyl-5-prop-1-ynyl-1-benzothiophen-2-yl)buta-1,3-dien-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 135231691) has the molecular formula C23H25ClN2O2S2 and a molecular weight of 461.05 g/mol. Its IUPAC name is (3R)-3-[(3E)-3-chloro-4-(3-methyl-5-prop-1-ynyl-1-benzothiophen-2-yl)buta-1,3-dien-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-[(3E)-3-chloro-4-(3-methyl-5-prop-1-ynyl-1-benzothiophen-2-yl)buta-1,3-dien-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 135231691 |
| Molecular Formula | C23H25ClN2O2S2 |
| Molecular Weight | 461.05 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (3R)-3-[(3E)-3-chloro-4-(3-methyl-5-prop-1-ynyl-1-benzothiophen-2-yl)buta-1,3-dien-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | C=C(/C(Cl)=C\c1sc2ccc(C#CC)cc2c1C)[C@]1(C)CS(=O)(=O)C(C)(C)C(N)=N1 |
| InChI | InChI=1S/C23H25ClN2O2S2/c1-7-8-16-9-10-19-17(11-16)14(2)20(29-19)12-18(24)15(3)23(6)13-30(27,28)22(4,5)21(25)26-23/h9-12H,3,13H2,1-2,4-6H3,(H2,25,26)/b18-12+/t23-/m0/s1 |
| InChIKey | IVLLLJPCCQQCAP-SJQUQUAPSA-N |
| XLogP | 5.04 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.05 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|