C29H45N9 — CID 135231809
2-N-[[3-[3-[3-(cyclohexylamino)propylamino]propyl]-1H-pyrazol-5-yl]methyl]-4-N-piperidin-4-ylquinazoline-2,4-diamine (PubChem CID 135231809) has the molecular formula C29H45N9 and a molecular weight of 519.74 g/mol. Its IUPAC name is 2-N-[[3-[3-[3-(cyclohexylamino)propylamino]propyl]-1H-pyrazol-5-yl]methyl]-4-N-piperidin-4-ylquinazoline-2,4-diamine.
| Compound Name | 2-N-[[3-[3-[3-(cyclohexylamino)propylamino]propyl]-1H-pyrazol-5-yl]methyl]-4-N-piperidin-4-ylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 135231809 |
| Molecular Formula | C29H45N9 |
| Molecular Weight | 519.74 g/mol |
| Exact Mass | 519.38 |
| IUPAC Name | 2-N-[[3-[3-[3-(cyclohexylamino)propylamino]propyl]-1H-pyrazol-5-yl]methyl]-4-N-piperidin-4-ylquinazoline-2,4-diamine |
| SMILES | c1ccc2c(NC3CCNCC3)nc(NCc3cc(CCCNCCCNC4CCCCC4)n[nH]3)nc2c1 |
| InChI | InChI=1S/C29H45N9/c1-2-8-22(9-3-1)32-17-7-16-30-15-6-10-24-20-25(38-37-24)21-33-29-35-27-12-5-4-11-26(27)28(36-29)34-23-13-18-31-19-14-23/h4-5,11-12,20,22-23,30-32H,1-3,6-10,13-19,21H2,(H,37,38)(H2,33,34,35,36) |
| InChIKey | YQNPFWHBIRRYBF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.74 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|