C21H42S — CID 135231893
(E)-3,7,11,15-tetramethyl-1-methylsulfanylhexadec-2-ene (PubChem CID 135231893) has the molecular formula C21H42S and a molecular weight of 326.63 g/mol. Its IUPAC name is (E)-3,7,11,15-tetramethyl-1-methylsulfanylhexadec-2-ene.
| Compound Name | (E)-3,7,11,15-tetramethyl-1-methylsulfanylhexadec-2-ene |
|---|---|
| PubChem CID | 135231893 |
| Molecular Formula | C21H42S |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | (E)-3,7,11,15-tetramethyl-1-methylsulfanylhexadec-2-ene |
| SMILES | CSC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C21H42S/c1-18(2)10-7-11-19(3)12-8-13-20(4)14-9-15-21(5)16-17-22-6/h16,18-20H,7-15,17H2,1-6H3/b21-16+ |
| InChIKey | DXJSZZYDGOJJJN-LTGZKZEYSA-N |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|