C21H5N11 — CID 135232341
6-(3-cyano-2-ethynylpyrazino[2,3-b]quinoxalin-7-yl)pyrazino[2,3-b]pyrazine-2,3-dicarbonitrile (PubChem CID 135232341) has the molecular formula C21H5N11 and a molecular weight of 411.35 g/mol. Its IUPAC name is 6-(3-cyano-2-ethynylpyrazino[2,3-b]quinoxalin-7-yl)pyrazino[2,3-b]pyrazine-2,3-dicarbonitrile.
| Compound Name | 6-(3-cyano-2-ethynylpyrazino[2,3-b]quinoxalin-7-yl)pyrazino[2,3-b]pyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 135232341 |
| Molecular Formula | C21H5N11 |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 6-(3-cyano-2-ethynylpyrazino[2,3-b]quinoxalin-7-yl)pyrazino[2,3-b]pyrazine-2,3-dicarbonitrile |
| SMILES | C#Cc1nc2nc3ccc(-c4cnc5nc(C#N)c(C#N)nc5n4)cc3nc2nc1C#N |
| InChI | InChI=1S/C21H5N11/c1-2-11-14(6-22)30-21-20(26-11)27-12-4-3-10(5-13(12)28-21)17-9-25-18-19(32-17)31-16(8-24)15(7-23)29-18/h1,3-5,9H |
| InChIKey | SWBRDLJIKWKKAL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 174.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|