C32H39N2O3+ — CID 135232467
6-(5,5,16,16-tetramethyl-2-oxa-8-aza-23-azoniahexacyclo[12.11.0.03,12.04,9.015,23.017,22]pentacosa-3(12),4(9),10,13,15(23),17,19,21-octaen-8-yl)hexanoic acid (PubChem CID 135232467) has the molecular formula C32H39N2O3+ and a molecular weight of 499.68 g/mol. Its IUPAC name is 6-(5,5,16,16-tetramethyl-2-oxa-8-aza-23-azoniahexacyclo[12.11.0.03,12.04,9.015,23.017,22]pentacosa-3(12),4(9),10,13,15(23),17,19,21-octaen-8-yl)hexanoic acid.
| Compound Name | 6-(5,5,16,16-tetramethyl-2-oxa-8-aza-23-azoniahexacyclo[12.11.0.03,12.04,9.015,23.017,22]pentacosa-3(12),4(9),10,13,15(23),17,19,21-octaen-8-yl)hexanoic acid |
|---|---|
| PubChem CID | 135232467 |
| Molecular Formula | C32H39N2O3+ |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | 6-(5,5,16,16-tetramethyl-2-oxa-8-aza-23-azoniahexacyclo[12.11.0.03,12.04,9.015,23.017,22]pentacosa-3(12),4(9),10,13,15(23),17,19,21-octaen-8-yl)hexanoic acid |
| SMILES | CC1(C)CCN(CCCCCC(=O)O)c2ccc3c(c21)OC1CC[N+]2=C(C1=C3)C(C)(C)c1ccccc12 |
| InChI | InChI=1S/C32H38N2O3/c1-31(2)16-19-33(17-9-5-6-12-27(35)36)25-14-13-21-20-22-26(37-29(21)28(25)31)15-18-34-24-11-8-7-10-23(24)32(3,4)30(22)34/h7-8,10-11,13-14,20,26H,5-6,9,12,15-19H2,1-4H3/p+1 |
| InChIKey | OPQPCRZPDHWLIA-UHFFFAOYSA-O |
| XLogP | 6.44 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|