About iodo-(2,4,6-trimethylphenyl)phosphane
iodo-(2,4,6-trimethylphenyl)phosphane (PubChem CID 135232521) has the molecular formula C9H12IP
and a molecular weight of 278.07 g/mol. Its IUPAC name is iodo-(2,4,6-trimethylphenyl)phosphane.
Molecular Properties
| Compound Name | iodo-(2,4,6-trimethylphenyl)phosphane |
| PubChem CID | 135232521 |
| Molecular Formula | C9H12IP |
| Molecular Weight | 278.07 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | iodo-(2,4,6-trimethylphenyl)phosphane |
| SMILES | Cc1cc(C)c(PI)c(C)c1 |
| InChI | InChI=1S/C9H12IP/c1-6-4-7(2)9(11-10)8(3)5-6/h4-5,11H,1-3H3 |
| InChIKey | RYTUZVSPAYTIDD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.07 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze iodo-(2,4,6-trimethylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo-(2,4,6-trimethylphenyl)phosphane?
The IUPAC name of iodo-(2,4,6-trimethylphenyl)phosphane (CID 135232521) is iodo-(2,4,6-trimethylphenyl)phosphane.
What is the SMILES notation for iodo-(2,4,6-trimethylphenyl)phosphane?
The canonical SMILES for iodo-(2,4,6-trimethylphenyl)phosphane is Cc1cc(C)c(PI)c(C)c1.
What is the InChIKey of iodo-(2,4,6-trimethylphenyl)phosphane?
The InChIKey is RYTUZVSPAYTIDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12IP/c1-6-4-7(2)9(11-10)8(3)5-6/h4-5,11H,1-3H3.
What are the key properties of iodo-(2,4,6-trimethylphenyl)phosphane?
iodo-(2,4,6-trimethylphenyl)phosphane has a molecular weight of 278.07 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iodo-(2,4,6-trimethylphenyl)phosphane is sourced from PubChem (CID 135232521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).