C6H8F5NO2 — CID 135232904
2-hydroxy-N-(2,2,3,3,3-pentafluoropropyl)propanamide (PubChem CID 135232904) has the molecular formula C6H8F5NO2 and a molecular weight of 221.12 g/mol. Its IUPAC name is 2-hydroxy-N-(2,2,3,3,3-pentafluoropropyl)propanamide.
| Compound Name | 2-hydroxy-N-(2,2,3,3,3-pentafluoropropyl)propanamide |
|---|---|
| PubChem CID | 135232904 |
| Molecular Formula | C6H8F5NO2 |
| Molecular Weight | 221.12 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 2-hydroxy-N-(2,2,3,3,3-pentafluoropropyl)propanamide |
| SMILES | CC(O)C(=O)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F5NO2/c1-3(13)4(14)12-2-5(7,8)6(9,10)11/h3,13H,2H2,1H3,(H,12,14) |
| InChIKey | WILHGPKXGQPJRB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.12 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|