C22H30F3N3O2 — CID 135233068
(4Z)-N-(3,3-difluorocyclopentyl)-2-[(3-fluorocyclohexa-1,3-dien-1-yl)-(methylaminooxy)amino]-3-propan-2-ylidenehepta-4,6-dienamide (PubChem CID 135233068) has the molecular formula C22H30F3N3O2 and a molecular weight of 425.50 g/mol. Its IUPAC name is (4Z)-N-(3,3-difluorocyclopentyl)-2-[(3-fluorocyclohexa-1,3-dien-1-yl)-(methylaminooxy)amino]-3-propan-2-ylidenehepta-4,6-dienamide.
| Compound Name | (4Z)-N-(3,3-difluorocyclopentyl)-2-[(3-fluorocyclohexa-1,3-dien-1-yl)-(methylaminooxy)amino]-3-propan-2-ylidenehepta-4,6-dienamide |
|---|---|
| PubChem CID | 135233068 |
| Molecular Formula | C22H30F3N3O2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | (4Z)-N-(3,3-difluorocyclopentyl)-2-[(3-fluorocyclohexa-1,3-dien-1-yl)-(methylaminooxy)amino]-3-propan-2-ylidenehepta-4,6-dienamide |
| SMILES | C=C/C=C\C(=C(C)C)C(C(=O)NC1CCC(F)(F)C1)N(ONC)C1=CC(F)=CCC1 |
| InChI | InChI=1S/C22H30F3N3O2/c1-5-6-10-19(15(2)3)20(21(29)27-17-11-12-22(24,25)14-17)28(30-26-4)18-9-7-8-16(23)13-18/h5-6,8,10,13,17,20,26H,1,7,9,11-12,14H2,2-4H3,(H,27,29)/b10-6- |
| InChIKey | OWBMZVDREIJQTF-POHAHGRESA-N |
| XLogP | 4.64 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|