C34H53NS — CID 135233141
(1E,6E,8E)-N-but-1-en-2-yl-12-(6-butyl-4H-thiopyran-2-yl)-5,8,9,11-tetramethyl-10-methylidene-6-prop-2-enyltrideca-1,6,8-trien-1-amine (PubChem CID 135233141) has the molecular formula C34H53NS and a molecular weight of 507.87 g/mol. Its IUPAC name is (1E,6E,8E)-N-but-1-en-2-yl-12-(6-butyl-4H-thiopyran-2-yl)-5,8,9,11-tetramethyl-10-methylidene-6-prop-2-enyltrideca-1,6,8-trien-1-amine.
| Compound Name | (1E,6E,8E)-N-but-1-en-2-yl-12-(6-butyl-4H-thiopyran-2-yl)-5,8,9,11-tetramethyl-10-methylidene-6-prop-2-enyltrideca-1,6,8-trien-1-amine |
|---|---|
| PubChem CID | 135233141 |
| Molecular Formula | C34H53NS |
| Molecular Weight | 507.87 g/mol |
| Exact Mass | 507.39 |
| IUPAC Name | (1E,6E,8E)-N-but-1-en-2-yl-12-(6-butyl-4H-thiopyran-2-yl)-5,8,9,11-tetramethyl-10-methylidene-6-prop-2-enyltrideca-1,6,8-trien-1-amine |
| SMILES | C=CC/C(=C\C(C)=C(/C)C(=C)C(C)C(C)C1=CCC=C(CCCC)S1)C(C)CC/C=C/NC(=C)CC |
| InChI | InChI=1S/C34H53NS/c1-11-14-20-33-21-17-22-34(36-33)31(10)30(9)29(8)28(7)26(5)24-32(18-12-2)25(4)19-15-16-23-35-27(6)13-3/h12,16,21-25,30-31,35H,2,6,8,11,13-15,17-20H2,1,3-5,7,9-10H3/b23-16+,28-26+,32-24+ |
| InChIKey | URGBMPLRQGIMPB-CIHZGEPRSA-N |
| XLogP | 11.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.87 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|