About 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine
5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine (PubChem CID 135233197) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 135233197 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine |
| SMILES | NC1=CC=CC(C2C=NNC2)C1 |
| InChI | InChI=1S/C9H13N3/c10-9-3-1-2-7(4-9)8-5-11-12-6-8/h1-3,5,7-8,12H,4,6,10H2 |
| InChIKey | XMIXTQXYFBJGSV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine?
The IUPAC name of 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine (CID 135233197) is 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine is NC1=CC=CC(C2C=NNC2)C1.
What is the InChIKey of 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine?
The InChIKey is XMIXTQXYFBJGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c10-9-3-1-2-7(4-9)8-5-11-12-6-8/h1-3,5,7-8,12H,4,6,10H2.
What are the key properties of 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine?
5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine has a molecular weight of 163.22 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-dihydro-1H-pyrazol-4-yl)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 135233197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).