C21H23NO2 — CID 135233265
methyl 3-[[3,5-bis(prop-2-enyl)phenyl]methylamino]benzoate (PubChem CID 135233265) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl 3-[[3,5-bis(prop-2-enyl)phenyl]methylamino]benzoate.
| Compound Name | methyl 3-[[3,5-bis(prop-2-enyl)phenyl]methylamino]benzoate |
|---|---|
| PubChem CID | 135233265 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | methyl 3-[[3,5-bis(prop-2-enyl)phenyl]methylamino]benzoate |
| SMILES | C=CCc1cc(CC=C)cc(CNc2cccc(C(=O)OC)c2)c1 |
| InChI | InChI=1S/C21H23NO2/c1-4-7-16-11-17(8-5-2)13-18(12-16)15-22-20-10-6-9-19(14-20)21(23)24-3/h4-6,9-14,22H,1-2,7-8,15H2,3H3 |
| InChIKey | LDUHVVFCAJPEFC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|