C21H34N6O2 — CID 135233325
2-(dimethylamino)-N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]acetamide (PubChem CID 135233325) has the molecular formula C21H34N6O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 135233325 |
| Molecular Formula | C21H34N6O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 2-(dimethylamino)-N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]acetamide |
| SMILES | CN(C)CC(=O)NC1CC=C(c2ccc(NCC(C)(C)C)c(N(C)N=O)n2)CC1 |
| InChI | InChI=1S/C21H34N6O2/c1-21(2,3)14-22-18-12-11-17(24-20(18)27(6)25-29)15-7-9-16(10-8-15)23-19(28)13-26(4)5/h7,11-12,16,22H,8-10,13-14H2,1-6H3,(H,23,28) |
| InChIKey | WMLPPMMRMSXPLS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|