C29H48N2S — CID 135233438
(Z)-2-butyl-7-[2-[2-methyl-4-[(E)-6-(methylamino)hex-5-en-2-yl]-6-methylidenecyclohexa-1,3-dien-1-yl]prop-2-enylamino]hept-2-ene-1-thiol (PubChem CID 135233438) has the molecular formula C29H48N2S and a molecular weight of 456.78 g/mol. Its IUPAC name is (Z)-2-butyl-7-[2-[2-methyl-4-[(E)-6-(methylamino)hex-5-en-2-yl]-6-methylidenecyclohexa-1,3-dien-1-yl]prop-2-enylamino]hept-2-ene-1-thiol.
| Compound Name | (Z)-2-butyl-7-[2-[2-methyl-4-[(E)-6-(methylamino)hex-5-en-2-yl]-6-methylidenecyclohexa-1,3-dien-1-yl]prop-2-enylamino]hept-2-ene-1-thiol |
|---|---|
| PubChem CID | 135233438 |
| Molecular Formula | C29H48N2S |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | (Z)-2-butyl-7-[2-[2-methyl-4-[(E)-6-(methylamino)hex-5-en-2-yl]-6-methylidenecyclohexa-1,3-dien-1-yl]prop-2-enylamino]hept-2-ene-1-thiol |
| SMILES | C=C(CNCCCC/C=C(\CS)CCCC)C1=C(C)C=C(C(C)CC/C=C/NC)CC1=C |
| InChI | InChI=1S/C29H48N2S/c1-7-8-15-27(22-32)16-10-9-12-18-31-21-26(5)29-24(3)19-28(20-25(29)4)23(2)14-11-13-17-30-6/h13,16-17,20,23,30-32H,3,5,7-12,14-15,18-19,21-22H2,1-2,4,6H3/b17-13+,27-16- |
| InChIKey | RXMVMFXKOSJJPQ-FZLPBURKSA-N |
| XLogP | 7.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|