C22H34N6O2 — CID 135233555
2-cyano-N-[5-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]-2,2-dimethylcyclohexyl]acetamide (PubChem CID 135233555) has the molecular formula C22H34N6O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-cyano-N-[5-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]-2,2-dimethylcyclohexyl]acetamide.
| Compound Name | 2-cyano-N-[5-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]-2,2-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 135233555 |
| Molecular Formula | C22H34N6O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 2-cyano-N-[5-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]-2,2-dimethylcyclohexyl]acetamide |
| SMILES | CN(N=O)c1nc(C2CCC(C)(C)C(NC(=O)CC#N)C2)ccc1NCC(C)(C)C |
| InChI | InChI=1S/C22H34N6O2/c1-21(2,3)14-24-17-8-7-16(25-20(17)28(6)27-30)15-9-11-22(4,5)18(13-15)26-19(29)10-12-23/h7-8,15,18,24H,9-11,13-14H2,1-6H3,(H,26,29) |
| InChIKey | JJDMLMFCCVZCJA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|