C21H28F3N5O2 — CID 135233665
N-[3-(2,2-dimethylpropylamino)-6-[2-(3,3,3-trifluoropropanoyl)-2-azabicyclo[2.2.2]oct-5-en-5-yl]-2-pyridinyl]-N-methylnitrous amide (PubChem CID 135233665) has the molecular formula C21H28F3N5O2 and a molecular weight of 439.48 g/mol. Its IUPAC name is N-[3-(2,2-dimethylpropylamino)-6-[2-(3,3,3-trifluoropropanoyl)-2-azabicyclo[2.2.2]oct-5-en-5-yl]-2-pyridinyl]-N-methylnitrous amide.
| Compound Name | N-[3-(2,2-dimethylpropylamino)-6-[2-(3,3,3-trifluoropropanoyl)-2-azabicyclo[2.2.2]oct-5-en-5-yl]-2-pyridinyl]-N-methylnitrous amide |
|---|---|
| PubChem CID | 135233665 |
| Molecular Formula | C21H28F3N5O2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | N-[3-(2,2-dimethylpropylamino)-6-[2-(3,3,3-trifluoropropanoyl)-2-azabicyclo[2.2.2]oct-5-en-5-yl]-2-pyridinyl]-N-methylnitrous amide |
| SMILES | CN(N=O)c1nc(C2=CC3CCC2CN3C(=O)CC(F)(F)F)ccc1NCC(C)(C)C |
| InChI | InChI=1S/C21H28F3N5O2/c1-20(2,3)12-25-17-8-7-16(26-19(17)28(4)27-31)15-9-14-6-5-13(15)11-29(14)18(30)10-21(22,23)24/h7-9,13-14,25H,5-6,10-12H2,1-4H3 |
| InChIKey | VJTSDHNBSXKHJG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|