C20H31N7O2S — CID 135233678
(Z)-2-amino-3-aminosulfanyl-N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]prop-2-enamide (PubChem CID 135233678) has the molecular formula C20H31N7O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is (Z)-2-amino-3-aminosulfanyl-N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]prop-2-enamide.
| Compound Name | (Z)-2-amino-3-aminosulfanyl-N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135233678 |
| Molecular Formula | C20H31N7O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (Z)-2-amino-3-aminosulfanyl-N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]prop-2-enamide |
| SMILES | CN(N=O)c1nc(C2=CCC(NC(=O)/C(N)=C/SN)CC2)ccc1NCC(C)(C)C |
| InChI | InChI=1S/C20H31N7O2S/c1-20(2,3)12-23-17-10-9-16(25-18(17)27(4)26-29)13-5-7-14(8-6-13)24-19(28)15(21)11-30-22/h5,9-11,14,23H,6-8,12,21-22H2,1-4H3,(H,24,28)/b15-11- |
| InChIKey | SDPXISSHYRITJW-PTNGSMBKSA-N |
| XLogP | 3.12 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|