C21H31N7O2S — CID 135233686
N-[6-[8-[(Z)-2-amino-3-aminosulfanylprop-2-enoyl]-8-azabicyclo[3.2.1]oct-2-en-3-yl]-3-(2,2-dimethylpropylamino)-2-pyridinyl]-N-methylnitrous amide (PubChem CID 135233686) has the molecular formula C21H31N7O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[6-[8-[(Z)-2-amino-3-aminosulfanylprop-2-enoyl]-8-azabicyclo[3.2.1]oct-2-en-3-yl]-3-(2,2-dimethylpropylamino)-2-pyridinyl]-N-methylnitrous amide.
| Compound Name | N-[6-[8-[(Z)-2-amino-3-aminosulfanylprop-2-enoyl]-8-azabicyclo[3.2.1]oct-2-en-3-yl]-3-(2,2-dimethylpropylamino)-2-pyridinyl]-N-methylnitrous amide |
|---|---|
| PubChem CID | 135233686 |
| Molecular Formula | C21H31N7O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | N-[6-[8-[(Z)-2-amino-3-aminosulfanylprop-2-enoyl]-8-azabicyclo[3.2.1]oct-2-en-3-yl]-3-(2,2-dimethylpropylamino)-2-pyridinyl]-N-methylnitrous amide |
| SMILES | CN(N=O)c1nc(C2=CC3CCC(C2)N3C(=O)/C(N)=C/SN)ccc1NCC(C)(C)C |
| InChI | InChI=1S/C21H31N7O2S/c1-21(2,3)12-24-18-8-7-17(25-19(18)27(4)26-30)13-9-14-5-6-15(10-13)28(14)20(29)16(22)11-31-23/h7-9,11,14-15,24H,5-6,10,12,22-23H2,1-4H3/b16-11- |
| InChIKey | UOMOBKPYVVCVHS-WJDWOHSUSA-N |
| XLogP | 3.21 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|