C23H36N6O3 — CID 135233842
N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]-4-methylmorpholine-2-carboxamide (PubChem CID 135233842) has the molecular formula C23H36N6O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]-4-methylmorpholine-2-carboxamide.
| Compound Name | N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]-4-methylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 135233842 |
| Molecular Formula | C23H36N6O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]-4-methylmorpholine-2-carboxamide |
| SMILES | CN1CCOC(C(=O)NC2CC=C(c3ccc(NCC(C)(C)C)c(N(C)N=O)n3)CC2)C1 |
| InChI | InChI=1S/C23H36N6O3/c1-23(2,3)15-24-19-11-10-18(26-21(19)29(5)27-31)16-6-8-17(9-7-16)25-22(30)20-14-28(4)12-13-32-20/h6,10-11,17,20,24H,7-9,12-15H2,1-5H3,(H,25,30) |
| InChIKey | OWWRDVOASWUDGG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|