C20H36N2 — CID 135234115
N-[(3Z,7Z)-6,9-dimethyldeca-3,7-dien-4-yl]-4-ethanimidoylcyclohexan-1-amine (PubChem CID 135234115) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is N-[(3Z,7Z)-6,9-dimethyldeca-3,7-dien-4-yl]-4-ethanimidoylcyclohexan-1-amine.
| Compound Name | N-[(3Z,7Z)-6,9-dimethyldeca-3,7-dien-4-yl]-4-ethanimidoylcyclohexan-1-amine |
|---|---|
| PubChem CID | 135234115 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | N-[(3Z,7Z)-6,9-dimethyldeca-3,7-dien-4-yl]-4-ethanimidoylcyclohexan-1-amine |
| SMILES | [H]/N=C(\C)C1CCC(N/C(=C\CC)CC(C)/C=C\C(C)C)CC1 |
| InChI | InChI=1S/C20H36N2/c1-6-7-20(14-16(4)9-8-15(2)3)22-19-12-10-18(11-13-19)17(5)21/h7-9,15-16,18-19,21-22H,6,10-14H2,1-5H3/b9-8-,20-7-,21-17+ |
| InChIKey | PREJHBBPKKHYMN-GUJYKEBASA-N |
| XLogP | 5.71 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|