About 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine
6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 135234318) has the molecular formula C23H22N6O
and a molecular weight of 398.47 g/mol. Its IUPAC name is 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine.
Molecular Properties
| Compound Name | 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine |
| PubChem CID | 135234318 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | Nc1nnc(-c2ccc3nccc(CN4CCOCC4)c3c2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H22N6O/c24-23-26-21(16-4-2-1-3-5-16)22(27-28-23)17-6-7-20-19(14-17)18(8-9-25-20)15-29-10-12-30-13-11-29/h1-9,14H,10-13,15H2,(H2,24,26,28) |
| InChIKey | JJMOFLSUCGCSJY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine?
The IUPAC name of 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine (CID 135234318) is 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine.
What is the SMILES notation for 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine?
The canonical SMILES for 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine is Nc1nnc(-c2ccc3nccc(CN4CCOCC4)c3c2)c(-c2ccccc2)n1.
What is the InChIKey of 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine?
The InChIKey is JJMOFLSUCGCSJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N6O/c24-23-26-21(16-4-2-1-3-5-16)22(27-28-23)17-6-7-20-19(14-17)18(8-9-25-20)15-29-10-12-30-13-11-29/h1-9,14H,10-13,15H2,(H2,24,26,28).
What are the key properties of 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine?
6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine has a molecular weight of 398.47 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(morpholin-4-ylmethyl)quinolin-6-yl]-5-phenyl-1,2,4-triazin-3-amine is sourced from PubChem (CID 135234318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).