C18H13FN6O — CID 135234390
5-(4-fluorophenyl)-6-(4-methoxyquinazolin-6-yl)-1,2,4-triazin-3-amine (PubChem CID 135234390) has the molecular formula C18H13FN6O and a molecular weight of 348.34 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-6-(4-methoxyquinazolin-6-yl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-fluorophenyl)-6-(4-methoxyquinazolin-6-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 135234390 |
| Molecular Formula | C18H13FN6O |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 5-(4-fluorophenyl)-6-(4-methoxyquinazolin-6-yl)-1,2,4-triazin-3-amine |
| SMILES | COc1ncnc2ccc(-c3nnc(N)nc3-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C18H13FN6O/c1-26-17-13-8-11(4-7-14(13)21-9-22-17)16-15(23-18(20)25-24-16)10-2-5-12(19)6-3-10/h2-9H,1H3,(H2,20,23,25) |
| InChIKey | UQOMFUFJBGNXHW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |