C21H15ClF2O3 — CID 135234429
(4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione (PubChem CID 135234429) has the molecular formula C21H15ClF2O3 and a molecular weight of 388.80 g/mol. Its IUPAC name is (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione.
| Compound Name | (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione |
|---|---|
| PubChem CID | 135234429 |
| Molecular Formula | C21H15ClF2O3 |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione |
| SMILES | C#CC[C@@H]1CC(=O)C(c2c(Cl)cc(-c3ccc(F)cc3F)cc2OC)C1=O |
| InChI | InChI=1S/C21H15ClF2O3/c1-3-4-11-8-17(25)20(21(11)26)19-15(22)7-12(9-18(19)27-2)14-6-5-13(23)10-16(14)24/h1,5-7,9-11,20H,4,8H2,2H3/t11-,20?/m1/s1 |
| InChIKey | JUDLFBPTDXSXNJ-UAPALYRASA-N |
| XLogP | 4.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|