C12H21N3 — CID 135234562
(3Z,5Z)-4-piperidin-1-ylhepta-1,3,5-triene-2,3-diamine (PubChem CID 135234562) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (3Z,5Z)-4-piperidin-1-ylhepta-1,3,5-triene-2,3-diamine.
| Compound Name | (3Z,5Z)-4-piperidin-1-ylhepta-1,3,5-triene-2,3-diamine |
|---|---|
| PubChem CID | 135234562 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (3Z,5Z)-4-piperidin-1-ylhepta-1,3,5-triene-2,3-diamine |
| SMILES | C=C(N)/C(N)=C(\C=C/C)N1CCCCC1 |
| InChI | InChI=1S/C12H21N3/c1-3-7-11(12(14)10(2)13)15-8-5-4-6-9-15/h3,7H,2,4-6,8-9,13-14H2,1H3/b7-3-,12-11- |
| InChIKey | PJLKVOGKKYXASY-RFJXNOEISA-N |
| XLogP | 1.69 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|