C22H20N4O2 — CID 135234605
4-[(2E,4E)-6-methyl-5-(6-methylimidazo[1,2-a]pyrazin-5-yl)hepta-2,4,6-trien-2-yl]oxyfuro[3,2-c]pyridine (PubChem CID 135234605) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-[(2E,4E)-6-methyl-5-(6-methylimidazo[1,2-a]pyrazin-5-yl)hepta-2,4,6-trien-2-yl]oxyfuro[3,2-c]pyridine.
| Compound Name | 4-[(2E,4E)-6-methyl-5-(6-methylimidazo[1,2-a]pyrazin-5-yl)hepta-2,4,6-trien-2-yl]oxyfuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 135234605 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-[(2E,4E)-6-methyl-5-(6-methylimidazo[1,2-a]pyrazin-5-yl)hepta-2,4,6-trien-2-yl]oxyfuro[3,2-c]pyridine |
| SMILES | C=C(C)/C(=C\C=C(/C)Oc1nccc2occc12)c1c(C)ncc2nccn12 |
| InChI | InChI=1S/C22H20N4O2/c1-14(2)17(21-16(4)25-13-20-23-10-11-26(20)21)6-5-15(3)28-22-18-8-12-27-19(18)7-9-24-22/h5-13H,1H2,2-4H3/b15-5+,17-6+ |
| InChIKey | RSTZDMNPOFNEOG-SYRYSZLJSA-N |
| XLogP | 5.12 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|