C39H71N7O2 — CID 135234608
6-tert-butyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 135234608) has the molecular formula C39H71N7O2 and a molecular weight of 670.04 g/mol. Its IUPAC name is 6-tert-butyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-tert-butyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 135234608 |
| Molecular Formula | C39H71N7O2 |
| Molecular Weight | 670.04 g/mol |
| Exact Mass | 669.57 |
| IUPAC Name | 6-tert-butyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(c1nc(N(C)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)nc(C(C)(C)C)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C39H71N7O2/c1-35(2,3)32-40-33(43(12)28-24-36(4,5)45(37(6,7)25-28)47-30-20-16-14-17-21-30)42-34(41-32)44(13)29-26-38(8,9)46(39(10,11)27-29)48-31-22-18-15-19-23-31/h28-31H,14-27H2,1-13H3 |
| InChIKey | JVJCFYXXNLSYBC-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.04 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |