C30H29F3N2O3 — CID 135234641
4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2-methoxybenzoic acid (PubChem CID 135234641) has the molecular formula C30H29F3N2O3 and a molecular weight of 522.57 g/mol. Its IUPAC name is 4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2-methoxybenzoic acid.
| Compound Name | 4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 135234641 |
| Molecular Formula | C30H29F3N2O3 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2-methoxybenzoic acid |
| SMILES | COc1cc(-c2cc(F)c([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3CC(C)(C)F)c(F)c2)ccc1C(=O)O |
| InChI | InChI=1S/C30H29F3N2O3/c1-16-11-21-19-7-5-6-8-24(19)34-27(21)28(35(16)15-30(2,3)33)26-22(31)12-18(13-23(26)32)17-9-10-20(29(36)37)25(14-17)38-4/h5-10,12-14,16,28,34H,11,15H2,1-4H3,(H,36,37)/t16-,28-/m1/s1 |
| InChIKey | JGVXMVXAWFXBSO-WVDZOPJMSA-N |
| XLogP | 6.90 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|