About (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine
(Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine (PubChem CID 135234790) has the molecular formula C7H11F3N2
and a molecular weight of 180.17 g/mol. Its IUPAC name is (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine.
Molecular Properties
| Compound Name | (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine |
| PubChem CID | 135234790 |
| Molecular Formula | C7H11F3N2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine |
| SMILES | [H]/N=C(/C=C\C(C)NC)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2/c1-5(12-2)3-4-6(11)7(8,9)10/h3-5,11-12H,1-2H3/b4-3-,11-6- |
| InChIKey | VIILPKREXIXALQ-ZRTVSTLASA-N |
| XLogP | 1.73 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine?
The IUPAC name of (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine (CID 135234790) is (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine.
What is the SMILES notation for (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine?
The canonical SMILES for (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine is [H]/N=C(/C=C\C(C)NC)C(F)(F)F.
What is the InChIKey of (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine?
The InChIKey is VIILPKREXIXALQ-ZRTVSTLASA-N. The full InChI is InChI=1S/C7H11F3N2/c1-5(12-2)3-4-6(11)7(8,9)10/h3-5,11-12H,1-2H3/b4-3-,11-6-.
What are the key properties of (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine?
(Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine has a molecular weight of 180.17 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6,6,6-trifluoro-5-imino-N-methylhex-3-en-2-amine is sourced from PubChem (CID 135234790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).