C14H28N2O — CID 135235081
N-[(2R,3R)-3-ethylpent-4-en-2-yl]-6-(methylamino)hexanamide (PubChem CID 135235081) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is N-[(2R,3R)-3-ethylpent-4-en-2-yl]-6-(methylamino)hexanamide.
| Compound Name | N-[(2R,3R)-3-ethylpent-4-en-2-yl]-6-(methylamino)hexanamide |
|---|---|
| PubChem CID | 135235081 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | N-[(2R,3R)-3-ethylpent-4-en-2-yl]-6-(methylamino)hexanamide |
| SMILES | C=C[C@@H](CC)[C@@H](C)NC(=O)CCCCCNC |
| InChI | InChI=1S/C14H28N2O/c1-5-13(6-2)12(3)16-14(17)10-8-7-9-11-15-4/h5,12-13,15H,1,6-11H2,2-4H3,(H,16,17)/t12-,13+/m1/s1 |
| InChIKey | SSNGSQIFIIBFPM-OLZOCXBDSA-N |
| XLogP | 2.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|