C14H31NS — CID 135235159
4,4,5,5-tetramethyl-N-(2-methylsulfanylpropan-2-yl)hexan-1-amine (PubChem CID 135235159) has the molecular formula C14H31NS and a molecular weight of 245.48 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-N-(2-methylsulfanylpropan-2-yl)hexan-1-amine.
| Compound Name | 4,4,5,5-tetramethyl-N-(2-methylsulfanylpropan-2-yl)hexan-1-amine |
|---|---|
| PubChem CID | 135235159 |
| Molecular Formula | C14H31NS |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | 4,4,5,5-tetramethyl-N-(2-methylsulfanylpropan-2-yl)hexan-1-amine |
| SMILES | CSC(C)(C)NCCCC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H31NS/c1-12(2,3)13(4,5)10-9-11-15-14(6,7)16-8/h15H,9-11H2,1-8H3 |
| InChIKey | PAPUEBNXPQEZHZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|