C14H22N2 — CID 135235284
5-tert-butyl-2,2,6-trimethyl-1,3-dihydrobenzimidazole (PubChem CID 135235284) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 5-tert-butyl-2,2,6-trimethyl-1,3-dihydrobenzimidazole.
| Compound Name | 5-tert-butyl-2,2,6-trimethyl-1,3-dihydrobenzimidazole |
|---|---|
| PubChem CID | 135235284 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 5-tert-butyl-2,2,6-trimethyl-1,3-dihydrobenzimidazole |
| SMILES | Cc1cc2c(cc1C(C)(C)C)NC(C)(C)N2 |
| InChI | InChI=1S/C14H22N2/c1-9-7-11-12(16-14(5,6)15-11)8-10(9)13(2,3)4/h7-8,15-16H,1-6H3 |
| InChIKey | PDXUUPCXTIRCSY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |