C12H19N — CID 135235496
(2E)-5-ethenyl-N,N,2-trimethylhepta-2,4,6-trien-1-amine (PubChem CID 135235496) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (2E)-5-ethenyl-N,N,2-trimethylhepta-2,4,6-trien-1-amine.
| Compound Name | (2E)-5-ethenyl-N,N,2-trimethylhepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 135235496 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2E)-5-ethenyl-N,N,2-trimethylhepta-2,4,6-trien-1-amine |
| SMILES | C=CC(C=C)=C/C=C(\C)CN(C)C |
| InChI | InChI=1S/C12H19N/c1-6-12(7-2)9-8-11(3)10-13(4)5/h6-9H,1-2,10H2,3-5H3/b11-8+ |
| InChIKey | DPKXRYRZKOQESY-DHZHZOJOSA-N |
| XLogP | 2.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|