C18H40N2O3 — CID 135235596
3-[2-(2-butoxyethoxy)ethoxymethyl]-N,N,N',N'-tetramethylpentane-1,5-diamine (PubChem CID 135235596) has the molecular formula C18H40N2O3 and a molecular weight of 332.53 g/mol. Its IUPAC name is 3-[2-(2-butoxyethoxy)ethoxymethyl]-N,N,N',N'-tetramethylpentane-1,5-diamine.
| Compound Name | 3-[2-(2-butoxyethoxy)ethoxymethyl]-N,N,N',N'-tetramethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 135235596 |
| Molecular Formula | C18H40N2O3 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.30 |
| IUPAC Name | 3-[2-(2-butoxyethoxy)ethoxymethyl]-N,N,N',N'-tetramethylpentane-1,5-diamine |
| SMILES | CCCCOCCOCCOCC(CCN(C)C)CCN(C)C |
| InChI | InChI=1S/C18H40N2O3/c1-6-7-12-21-13-14-22-15-16-23-17-18(8-10-19(2)3)9-11-20(4)5/h18H,6-17H2,1-5H3 |
| InChIKey | QAHOLDGHWFSTHS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|