About 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine
7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine (PubChem CID 135235659) has the molecular formula C20H16F2N4O2
and a molecular weight of 382.37 g/mol. Its IUPAC name is 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine |
| PubChem CID | 135235659 |
| Molecular Formula | C20H16F2N4O2 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine |
| SMILES | COCC(F)(F)c1ccc(Oc2ncccc2-c2cccc3ccnn23)cn1 |
| InChI | InChI=1S/C20H16F2N4O2/c1-27-13-20(21,22)18-8-7-15(12-24-18)28-19-16(5-3-10-23-19)17-6-2-4-14-9-11-25-26(14)17/h2-12H,13H2,1H3 |
| InChIKey | GQCSTRNZEZKDMR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine?
The IUPAC name of 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine (CID 135235659) is 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine.
What is the SMILES notation for 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine?
The canonical SMILES for 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine is COCC(F)(F)c1ccc(Oc2ncccc2-c2cccc3ccnn23)cn1.
What is the InChIKey of 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine?
The InChIKey is GQCSTRNZEZKDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2N4O2/c1-27-13-20(21,22)18-8-7-15(12-24-18)28-19-16(5-3-10-23-19)17-6-2-4-14-9-11-25-26(14)17/h2-12H,13H2,1H3.
What are the key properties of 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine?
7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine has a molecular weight of 382.37 g/mol, XLogP of 4.32, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-3-pyridinyl]pyrazolo[1,5-a]pyridine is sourced from PubChem (CID 135235659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).