C26H21F3N2O5S — CID 135235673
[2,2,2-trifluoro-1-[4-[[3-(4-methoxy-3-pyridinyl)-2-pyridinyl]oxy]phenyl]ethyl] 4-methylbenzenesulfonate (PubChem CID 135235673) has the molecular formula C26H21F3N2O5S and a molecular weight of 530.52 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-[4-[[3-(4-methoxy-3-pyridinyl)-2-pyridinyl]oxy]phenyl]ethyl] 4-methylbenzenesulfonate.
| Compound Name | [2,2,2-trifluoro-1-[4-[[3-(4-methoxy-3-pyridinyl)-2-pyridinyl]oxy]phenyl]ethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135235673 |
| Molecular Formula | C26H21F3N2O5S |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | [2,2,2-trifluoro-1-[4-[[3-(4-methoxy-3-pyridinyl)-2-pyridinyl]oxy]phenyl]ethyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccncc1-c1cccnc1Oc1ccc(C(OS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H21F3N2O5S/c1-17-5-11-20(12-6-17)37(32,33)36-24(26(27,28)29)18-7-9-19(10-8-18)35-25-21(4-3-14-31-25)22-16-30-15-13-23(22)34-2/h3-16,24H,1-2H3 |
| InChIKey | FXHULRYKEVEIGM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|