About 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine
4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine (PubChem CID 135235928) has the molecular formula C17H11ClF3N3O
and a molecular weight of 365.74 g/mol. Its IUPAC name is 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine.
Molecular Properties
| Compound Name | 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine |
| PubChem CID | 135235928 |
| Molecular Formula | C17H11ClF3N3O |
| Molecular Weight | 365.74 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine |
| SMILES | CC(F)(F)c1ccc(Oc2ncccc2-c2cncc(F)c2Cl)cn1 |
| InChI | InChI=1S/C17H11ClF3N3O/c1-17(20,21)14-5-4-10(7-24-14)25-16-11(3-2-6-23-16)12-8-22-9-13(19)15(12)18/h2-9H,1H3 |
| InChIKey | WFROKVZRMWMROG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.74 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine?
The IUPAC name of 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine (CID 135235928) is 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine.
What is the SMILES notation for 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine?
The canonical SMILES for 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine is CC(F)(F)c1ccc(Oc2ncccc2-c2cncc(F)c2Cl)cn1.
What is the InChIKey of 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine?
The InChIKey is WFROKVZRMWMROG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClF3N3O/c1-17(20,21)14-5-4-10(7-24-14)25-16-11(3-2-6-23-16)12-8-22-9-13(19)15(12)18/h2-9H,1H3.
What are the key properties of 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine?
4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine has a molecular weight of 365.74 g/mol, XLogP of 5.24, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-5-fluoropyridine is sourced from PubChem (CID 135235928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).