C24H18F2N4O3S — CID 135236233
1-[3-[(3-cyanophenyl)-difluoromethyl]phenyl]-6-(methanesulfonamido)indole-2-carboxamide (PubChem CID 135236233) has the molecular formula C24H18F2N4O3S and a molecular weight of 480.50 g/mol. Its IUPAC name is 1-[3-[(3-cyanophenyl)-difluoromethyl]phenyl]-6-(methanesulfonamido)indole-2-carboxamide.
| Compound Name | 1-[3-[(3-cyanophenyl)-difluoromethyl]phenyl]-6-(methanesulfonamido)indole-2-carboxamide |
|---|---|
| PubChem CID | 135236233 |
| Molecular Formula | C24H18F2N4O3S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 1-[3-[(3-cyanophenyl)-difluoromethyl]phenyl]-6-(methanesulfonamido)indole-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc2cc(C(N)=O)n(-c3cccc(C(F)(F)c4cccc(C#N)c4)c3)c2c1 |
| InChI | InChI=1S/C24H18F2N4O3S/c1-34(32,33)29-19-9-8-16-11-22(23(28)31)30(21(16)13-19)20-7-3-6-18(12-20)24(25,26)17-5-2-4-15(10-17)14-27/h2-13,29H,1H3,(H2,28,31) |
| InChIKey | LNZPZRXQWYLDBP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |