C11H19F4O3P — CID 135236410
[1,1,1-trifluoro-3-(2-fluorocyclohexyl)pentan-3-yl]phosphonic acid (PubChem CID 135236410) has the molecular formula C11H19F4O3P and a molecular weight of 306.24 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-(2-fluorocyclohexyl)pentan-3-yl]phosphonic acid.
| Compound Name | [1,1,1-trifluoro-3-(2-fluorocyclohexyl)pentan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 135236410 |
| Molecular Formula | C11H19F4O3P |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [1,1,1-trifluoro-3-(2-fluorocyclohexyl)pentan-3-yl]phosphonic acid |
| SMILES | CCC(CC(F)(F)F)(C1CCCCC1F)P(=O)(O)O |
| InChI | InChI=1S/C11H19F4O3P/c1-2-10(19(16,17)18,7-11(13,14)15)8-5-3-4-6-9(8)12/h8-9H,2-7H2,1H3,(H2,16,17,18) |
| InChIKey | IMQAZDQQLSRRHV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|