C20H25BrF3NO4 — CID 135237420
[(2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-yl] 2-bromo-7-azaspiro[3.5]nonane-7-carboxylate (PubChem CID 135237420) has the molecular formula C20H25BrF3NO4 and a molecular weight of 480.32 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-yl] 2-bromo-7-azaspiro[3.5]nonane-7-carboxylate.
| Compound Name | [(2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-yl] 2-bromo-7-azaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 135237420 |
| Molecular Formula | C20H25BrF3NO4 |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | [(2R)-1,1,1-trifluoro-3-[(4-methoxyphenyl)methoxy]propan-2-yl] 2-bromo-7-azaspiro[3.5]nonane-7-carboxylate |
| SMILES | COc1ccc(COC[C@@H](OC(=O)N2CCC3(CC2)CC(Br)C3)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H25BrF3NO4/c1-27-16-4-2-14(3-5-16)12-28-13-17(20(22,23)24)29-18(26)25-8-6-19(7-9-25)10-15(21)11-19/h2-5,15,17H,6-13H2,1H3/t17-/m1/s1 |
| InChIKey | FNYYUQOWNWQANZ-QGZVFWFLSA-N |
| XLogP | 4.92 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|